--- /dev/null
+dump('Loading util.js\n');
+
+var timer = {};
+var counter = {};
+var treeitem_id = 0;
+
+function snd_bad() {
+ mw.G.sound.play( xp_url_init('chrome://evergreen/content/media/redalert.wav') );
+}
+
+function snd_really_bad() {
+ mw.G.sound.play( xp_url_init('chrome://evergreen/content/media/die.wav') );
+}
+
+function snd_good() {
+ mw.G.sound.play( xp_url_init('chrome://evergreen/content/media/turn.wav') );
+}
+
+function snd_circ_good() {
+ mw.G.sound.play( xp_url_init('chrome://evergreen/content/media/clicked.wav') );
+}
+
+function snd_circ_bad() {
+ mw.G.sound.play( xp_url_init('chrome://evergreen/content/media/cow.wav') );
+}
+
+function snd_logon() {
+
+}
+
+function snd_logoff() {
+
+}
+
+function snd_exit() {
+
+}
+
+function handle_error(E) {
+ var s = '';
+ if (instanceOf(E,ex)) {
+ s += E.err_msg();
+ //s += '\n\n=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=\n\n';
+ //s += 'This error was anticipated.\n\n';
+ //s += js2JSON(E).substr(0,200) + '...\n\n';
+ snd_bad()
+ } else {
+ s += '\n\n=-=-=-=-=-=-=-=-=-=-=-=-=-=-=-=\n\n';
+ s += 'This is a bug that we will fix later.\n\n';
+ s += js2JSON(E).substr(0,200) + '\n\n';
+ snd_really_bad();
+ }
+ s_alert(s);
+}
+
+function string_to_array(s) {
+ var my_array = [];
+ for (var i = 0; i < s.length; i++ ) {
+ my_array.push( s.charAt(i) );
+ }
+ return my_array;
+}
+
+function textbox_checkdigit(ev) {
+ if ( check_checkdigit( ev.target.value ) ) {
+ dump('success\n');
+ return true;
+ } else {
+ dump('failure\n');
+ ev.preventDefault();
+ ev.stopPropagation();
+ return false;
+ }
+}
+
+function check_checkdigit(barcode) {
+
+ var stripped_barcode = barcode.slice(0,-1);
+ var checkdigit = barcode.slice(-1);
+
+ dump('\n\n=-=***=-=\n\ncheck_checkdigit: barcode = ' + barcode + ' barcode stripped = ' + stripped_barcode + ' checkdigit = ' + checkdigit + '\n');
+
+ var sum = 0; var mul = 2;
+
+ var b_array = string_to_array( stripped_barcode ).reverse();
+ dump( '\tb_array = ' + b_array + '\n');
+
+ for (var i in b_array) {
+ var digit = parseInt( b_array[i] );
+ dump('\t\tdigit = ' + digit + '\n');
+
+ var product = digit * mul;
+ if (mul == 2) { mul = 1; } else { mul = 2; }
+
+ var p_array = string_to_array( product.toString() );
+ dump( '\t\tp_array = ' + p_array + '\n');
+
+ for (var j in p_array) {
+ var n = parseInt( p_array[j] );
+ dump('\t\t\tn = ' + n + '\n');
+ sum += n;
+ }
+ }
+
+ dump('\tsum = ' + sum + '\n');
+
+ var s_array = string_to_array( sum.toString() );
+ var calculated_checkdigit = s_array.pop();
+ if (calculated_checkdigit > 0) calculated_checkdigit = 10 - calculated_checkdigit;
+ dump('\tcalculated checkdigit = ' + calculated_checkdigit + '\n\n=-=***=-=\n\n');
+
+ return ( calculated_checkdigit == checkdigit );
+}
+
+function fake_tab_for_textboxes(w,current) {
+ var flag = false; var next_one;
+ if (typeof(w)!='object') {
+ w = document.getElementById(w);
+ }
+ dump('fake_tab_for_textboxes: Current ' + current + '\n');
+ var nl = w.getElementsByTagName('textbox');
+ //var nl = document.getElementsByTagName('textbox');
+ dump('fake_tab_for_textboxes: nl.length = ' + nl.length + '\n');
+ for (var i = 0; i < nl.length; i++) {
+ dump('fake_tab_for_textboxes: Considering ' + nl[i] + '...\n');
+ if (flag && !next_one) {
+ dump('fake_tab_for_textboxes: Setting next_one ' + nl[i] + '\n');
+ next_one = nl[i];
+ }
+ if (nl[i] === current) {
+ dump('fake_tab_for_textboxes: Found current\n');
+ flag = true;
+ }
+ }
+ if (!next_one) {
+ dump('fake_tab_for_textboxes: Out of loop, Setting next_one ' + nl[0] + '\n');
+ next_one = nl[0];
+ }
+ if (next_one) {
+ next_one.focus(); next_one.select();
+ } else {
+ dump('fake_tab_for_textboxes: next_one not set\n');
+ }
+}
+
+function get_list_from_tree_selection(tree_w) {
+ dump('entering get_list_from_tree...\n');
+ var hitlist;
+ if (typeof(tree_w) != 'object') {
+ hitlist = document.getElementById(tree_w);
+ } else {
+ hitlist = tree_w;
+ }
+ var list = [];
+ var start = new Object();
+ var end = new Object();
+ var numRanges = hitlist.view.selection.getRangeCount();
+ for (var t=0; t<numRanges; t++){
+ hitlist.view.selection.getRangeAt(t,start,end);
+ for (var v=start.value; v<=end.value; v++){
+ var i = hitlist.contentView.getItemAtIndex(v);
+ //dump(i.tagName + '\n');
+ list.push( i );
+ }
+ }
+ dump('leaving get_list_from_tree...\n');
+ return list;
+}
+
+function yesno(value) {
+ switch(value) {
+ case true: case 'true': case '1': case 'on':
+ return 'Yes';
+ default:
+ return 'No';
+ }
+}
+
+function formatted_date(date,format) {
+ // pass in a Date object or epoch seconds
+ if (typeof(date) == 'string') {
+ date = new Date( parseInt( date + '000' ) );
+ }
+ var mm = date.getMonth() + 1;
+ mm = mm.toString();
+ if (mm.length == 1) mm = '0' +mm;
+ var dd = date.getDate().toString();
+ if (dd.length == 1) dd = '0' +dd;
+ var yyyy = date.getFullYear().toString();
+ var s = format.replace( /%m/g, mm );
+ s = s.replace( /%d/g, dd );
+ s = s.replace( /%Y/g, yyyy );
+ return s;
+}
+
+function interval_to_seconds ( $interval ) {
+
+ $interval = $interval.replace( /and/, ',' );
+ $interval = $interval.replace( /,/, ' ' );
+
+ var $amount = 0;
+ var results = $interval.match( /\s*\+?\s*(\d+)\s*(\w{1})\w*\s*/g);
+ for (var i in results) {
+ var result = results[i].match( /\s*\+?\s*(\d+)\s*(\w{1})\w*\s*/ );
+ if (result[2] == 's') $amount += result[1] ;
+ if (result[2] == 'm') $amount += 60 * result[1] ;
+ if (result[2] == 'h') $amount += 60 * 60 * result[1] ;
+ if (result[2] == 'd') $amount += 60 * 60 * 24 * result[1] ;
+ if (result[2] == 'w') $amount += 60 * 60 * 24 * 7 * result[1] ;
+ if (result[2] == 'M') $amount += ((60 * 60 * 24 * 365)/12) * result[1] ;
+ if (result[2] == 'y') $amount += 60 * 60 * 24 * 365 * result[1] ;
+ }
+ return $amount;
+}
+
+function debug() {
+ var s = '';
+ for (var i = 0; i < arguments.length; i++) {
+ s = s + arguments[i];
+ }
+ //dump('debug:' + s + '\n');
+}
+
+
+function counter_init(id) {
+ counter[id] = 0;
+}
+
+function counter_incr(id) {
+ if (! counter[id]) { counter_init(id); }
+ return ++counter[id];
+}
+
+function counter_peek(id) {
+ if (! counter[id]) { return 0; }
+ return counter[id];
+}
+
+function timer_init(id) {
+ timer[id] = (new Date).getTime();
+}
+
+function timer_elapsed(id) {
+ if (! timer[id]) { timer_init(id); }
+ var ms = (new Date).getTime() - timer[id];
+ return( ms + 'ms (' + ms/1000 + 's)' );
+}
+
+function dump_ns_node( node ) {
+ return (
+ 'id=<' +
+ node[fieldmap["Fieldmapper::biblio::record_node"].fields.id.position]
+ + '> intra-id=<' +
+ node[fieldmap["Fieldmapper::biblio::record_node"].fields.intra_doc_id.position]
+ + '> name=<' +
+ node[fieldmap["Fieldmapper::biblio::record_node"].fields.name.position]
+ + '> node_type=<' +
+ node[fieldmap["Fieldmapper::biblio::record_node"].fields.type.position]
+ + '> parent_node=<' +
+ node[fieldmap["Fieldmapper::biblio::record_node"].fields.parent_node.position]
+ + '> '
+ );
+}
+
+function nodeset2tree(ns) {
+ for (var i in ns) {
+ if (ns[i].parent_node) {
+ ns_addChild(
+ ns,
+ ns[i].parent_node,
+ ns[i].intra_doc_id
+ );
+ }
+ }
+ return ns;
+}
+
+function ns_addChild(ns,p,c) {
+ if (! ns[p].children ) { ns[p].children = []; }
+ ns[p].children.push(ns[c]);
+}
+
+function print_tabs(t) {
+ var r = '';
+ for (var j = 0; j < t; j++ ) { r = r + "\t"; }
+ return r;
+}
+
+function pretty_print(s) {
+ var r = ''; var t = 0;
+ for (var i in s) {
+ if (s[i] == '{') {
+ r = r + "\n" + print_tabs(t) + s[i]; t++;
+ r = r + "\n" + print_tabs(t);
+ } else if (s[i] == '[') {
+ r = r + "\n" + print_tabs(t) + s[i]; t++;
+ r = r + "\n" + print_tabs(t);
+ } else if (s[i] == '}') {
+ t--; r = r + "\n" + print_tabs(t) + s[i];
+ r = r + "\n" + print_tabs(t);
+ } else if (s[i] == ']') {
+ t--; r = r + "\n" + print_tabs(t) + s[i];
+ r = r + "\n" + print_tabs(t);
+ } else if (s[i] == ',') {
+ r = r + s[i];
+ r = r + "\n" + print_tabs(t);
+ } else {
+ r = r + s[i];
+ }
+ }
+ return r;
+}
+
+function enable_widgets() {
+ for (var i = 0; i < arguments.length; i++) {
+ if (typeof(arguments[i]) == 'object') {
+ dump(arguments[i] + '.disabled = false;\n');
+ arguments[i].disabled = false;
+ } else {
+ var w = document.getElementById( arguments[i] );
+ if (w) {
+ dump(w + '.disabled = false;\n');
+ w.disabled = false;
+ }
+ }
+ }
+}
+
+function disable_widgets() {
+ for (var i = 0; i < arguments.length; i++) {
+ if (typeof(arguments[i]) == 'object') {
+ dump(arguments[i] + '.disabled = true;\n');
+ arguments[i].disabled = true;
+ } else {
+ var w = document.getElementById( arguments[i] );
+ if (w) {
+ dump(w + '.disabled = true;\n');
+ w.disabled = true;
+ }
+ }
+ }
+}
+
+function focus_widget(e) {
+ if (typeof(e) == 'object') {
+ e.focus();
+ } else {
+ var w = document.getElementById(e);
+ if (w) { w.focus(); }
+ }
+}
+
+function empty_widget(e) {
+ if (typeof(e) != 'object') { e = document.getElementById(e); }
+ if (typeof(e) != 'object') { dump('Failed on empty_widget\n'); return; }
+ while (e.lastChild) { e.removeChild(e.lastChild); }
+}
+
+function empty_listbox(e) {
+ if (typeof(e) != 'object') { e = document.getElementById(e); }
+ if (typeof(e) != 'object') { dump('Failed on empty_listbox\n'); return; }
+ var nl = e.getElementsByTagName('listitem');
+ for (var i = 0; i < nl.length; i++) {
+ e.removeChild(nl[i]);
+ }
+}
+
+function swap_attributes(e,a1,a2) {
+ if (typeof(e) != 'object') { e = document.getElementById(e); }
+ if (typeof(e) != 'object') { dump('Failed on swap_attributes\n'); return; }
+ var a1_v = e.getAttribute(a1);
+ var a2_v = e.getAttribute(a2);
+ e.setAttribute(a1,a2_v);
+ e.setAttribute(a2, a1_v);
+ dump('before: a1 = ' + a1_v + ' a2 = ' + a2_v + ' and ');
+ dump('after: a1 = ' + a2_v + ' a2 = ' + a1_v + '\n');
+}
+
+function cycle_attribute(e,a,v) {
+ try {
+ if (typeof(e) != 'object') { e = document.getElementById(e); }
+ if (typeof(e) != 'object') { throw('typeof e != object : typeof e = ' + typeof(e)); }
+ if (!a) { throw('!a : a = ' + a); }
+ if (! e.getAttribute(a) ) { throw(' ! e.getAttribute(a) : a = ' + a); }
+ if (typeof(v) != 'object') { throw('typeof v != object : typeof v = ' + typeof(v)); }
+
+ var toggle = e.getAttribute(a);
+ var next_one = false;
+ dump('cycling ' + a + ' on ' + e.getAttribute('id') + ' to ');
+ for (var i = 0; i < v.length; i++) {
+ if (next_one) {
+ e.setAttribute(a,v[i]);
+ dump(v[i] + '\n');
+ return v[i];
+ }
+ if (toggle == v[i]) {
+ next_one = true;
+ }
+ }
+ if (next_one) {
+ e.setAttribute(a,v[0]);
+ dump(v[0] + '\n');
+ return v[0];
+ } else {
+ throw('current value not in list');
+ }
+ } catch(E) {
+ dump('cycle_attribute error: ' + js2JSON(E) + '\n');
+ dump('null\n');
+ return null;
+ }
+}
+
+
+function radio_checkbox(ev) {
+ var target = ev.target;
+ var group = target.getAttribute('group');
+ if (group) {
+ var nl = document.getElementsByTagName('checkbox');
+ for (var i in nl) {
+ if (typeof(nl[i])=='object') {
+ var c = nl[i];
+ var cgroup = c.getAttribute('group');
+ if (cgroup == group) {
+ c.checked = false;
+ }
+ }
+ }
+ target.checked = true;
+ } else {
+ dump('radio_checkbox: Checkbox must have a group attribute to find peers');
+ }
+}
+
+function toggle_hidden_grid_rows(grid) {
+ if (typeof(grid) != 'object') {
+ grid = document.getElementById(grid);
+ }
+ if (!grid) { return; }
+ var rows = grid.lastChild; if (!rows) { return; }
+ for (var r = 0; r < rows.childNodes.length; r++ ) {
+ var row = rows.childNodes[r];
+ if (typeof(row) == 'object') {
+ //dump('toggle row = ' + row + '\n');
+ var hidden = row.getAttribute('hidden');
+ if (hidden == 'true') {
+ row.setAttribute('hidden','false');
+ } else {
+ row.setAttribute('hidden','true');
+ }
+ }
+ }
+}
+
+/* The first parameter is the id of the element to set, or an array of ids for elements to set in batch. The second parameter is an object containing the attribute/value pairs to assign to the element or elements */
+function xul_setAttributes(el,attrs) {
+ if (typeof(el) == 'object') {
+ for (var e in el) {
+ var w = document.getElementById(e);
+ for (var a in attrs) {
+ w.setAttribute(a,attrs[a]);
+ }
+ }
+ } else {
+ var w = document.getElementById(el);
+ for (var a in attrs) {
+ w.setAttribute(a,attrs[a]);
+ }
+ }
+}
+
+function append_treeitem() {
+ var id = arguments[0];
+ var treechildren = document.getElementById(id);
+ if (!treechildren) { dump('No ' + id + ' to append to\n'); return; }
+ var treeitem = document.createElement('treeitem'); treechildren.appendChild(treeitem);
+ var treerow = document.createElement('treerow'); treeitem.appendChild(treerow);
+ for (var i = 1; i < arguments.length ; i++ ) {
+ var treecell = document.createElement('treecell'); treerow.appendChild(treecell);
+ treecell.setAttribute('label',arguments[i]);
+ treecell.setAttribute('id', 'treeitem_' + treeitem_id + '_' + i);
+ //dump('treecell.label = ' + arguments[i] + '\n');
+ }
+ return treeitem_id++;
+}
+
+function set_decks(params) {
+ for (var deck_id in params) {
+ var deck = document.getElementById( deck_id )
+ if (deck) deck.setAttribute( 'selectedIndex', params[deck_id] );
+ }
+}
+
+function super_dump(o,t) {
+ var s = "\n";
+ for (var ii = 0; ii < t; ii++) { s = s + '\t'; }
+ s = s + "=-=-=\n";
+ s = s + 'o.constructor == Array = ' + (o.constructor == Array) + '\n';
+ for (var ii = 0; ii < t; ii++) { s = s + '\t'; }
+ s = s + "typeof = " + typeof(o) + "\n";
+ try {
+ var string = new XMLSerializer().serializeToString(o);
+ return( string + "\n" );
+ } catch( E ) {
+ var i;
+ var c = 0;
+ for (i in o) {
+ switch(typeof(i)) {
+ case 'object':
+ s = s + super_dump(i,t+1);
+ break;
+ default :
+ var value = o[i];
+ for (var ii = 0; ii < t; ii++) { s = s + '\t'; }
+ s = s + "\tMember#" + c++ + "\tType:" + typeof(value);
+ if (typeof(value) == 'object') {
+ value = super_dump(value,t+1);
+ }
+ s = s + "\ttoString:" + i.toString() + "\tvalue:" + value + "\n";
+ break;
+ }
+ }
+ return( s + "\n" );
+ }
+}
+
+function super_dump_norecurse(o,t) {
+ var s = "\n";
+ for (var ii = 0; ii < t; ii++) { s = s + '\t'; }
+ s = s + "=-=-=\n";
+ s = s + 'o.constructor == Array = ' + (o.constructor == Array) + '\n';
+ for (var ii = 0; ii < t; ii++) { s = s + '\t'; }
+ s = s + "typeof = " + typeof(o) + "\n";
+ try {
+ var string = new XMLSerializer().serializeToString(o);
+ return( string + "\n" );
+ } catch( E ) {
+ var i;
+ var c = 0;
+ for (i in o) {
+ switch(typeof(i)) {
+ default :
+ var value = o[i];
+ for (var ii = 0; ii < t; ii++) { s = s + '\t'; }
+ s = s + "\tMember#" + c++ + "\tType:" + typeof(value);
+ s = s + "\ttoString:" + i.toString() + "\n";
+ break;
+ }
+ }
+ return( s + "\n" );
+ }
+}
+
+function get_my_orgs(user_ou) {
+
+ // self and ancestors
+ var current_item_id = user_ou.id();
+ //dump('mw.G[user_ou] = ' + js2JSON(mw.G['user_ou']) + '\n');
+ //dump('current_item_id = ' + current_item_id + '\n');
+ var item_ou; var my_orgs = {}; var other_orgs = {};
+ while( item_ou = find_ou(mw.G['org_tree'],current_item_id) ) {
+ //dump('\titem_ou = ' + js2JSON(item_ou) + '\n');
+ my_orgs[ item_ou.id() ] = item_ou;
+ current_item_id = item_ou.parent_ou();
+ if (!current_item_id) { break; }
+ }
+
+ current_item_id = user_ou.id();
+ //dump('self & ancestors : my_orgs = <<<'+js2JSON(my_orgs)+'>>>\n');
+ // descendants
+ var my_children;
+ var find_ou_result = find_ou(mw.G['org_tree'],current_item_id);
+ if (find_ou_result) {
+ my_children = find_ou_result.children() }
+ else {
+ dump('ERROR: find_ou(org_tree,'+current_item_id+') returned with no properties\n');
+ };
+ //dump('my_children: ' + my_children + ' : ' + js2JSON(my_children) + '\n');
+ if (my_children) {
+ for (var i = 0; i < my_children.length; i++) {
+ var my_child = my_children[i];
+ my_orgs[ my_child.id() ] = my_child;
+ //dump('my_child.children(): ' + my_child.children() + ' : ' + js2JSON(my_child.children()) + '\n');
+ if (my_child.children() != null) {
+ for (var j = 0; j < my_child.children().length; j++) {
+ var my_gchild = my_child.children()[j];
+ my_orgs[ my_gchild.id() ] = my_gchild;
+ }
+ }
+ }
+ }
+ //dump('& descendants : my_orgs = <<<'+js2JSON(my_orgs)+'>>>\n');
+ return my_orgs;
+}
+
+function get_other_orgs(org,other_orgs) {
+}
+
+function flatten_ou_branch(branch) {
+ //dump('flatten: branch = ' + js2JSON(branch) + '\n');
+ var my_array = new Array();
+ my_array.push( branch );
+ for (var i in branch.children() ) {
+ var child = branch.children()[i];
+ if (child != null) {
+ var temp_array = flatten_ou_branch(child);
+ for (var j in temp_array) {
+ my_array.push( temp_array[j] );
+ }
+ }
+ }
+ return my_array;
+}
+
+function find_ou(tree,id) {
+ if (typeof(id)=='object') { id = id.id(); }
+ if (tree.id()==id) {
+ return tree;
+ }
+ for (var i in tree.children()) {
+ var child = tree.children()[i];
+ ou = find_ou( child, id );
+ if (ou) { return ou; }
+ }
+ return null;
+}
+
+function find_tree_via_children(tree,children_func,find_func) {
+ if (typeof(tree)!='object') tree = document.getElementById(tree);
+
+ var t = find_func(tree); if (t) return t;
+
+ var c = children_func(tree);
+
+ for (var i = 0; i < c.length; i++) {
+ t = find_func( c[i] );
+ if (t) return t;
+ }
+}
+
+function filter_list(list,f) {
+ var new_list = [];
+ for (var i in list) {
+ var t = f( list[i] );
+ if (t) new_list.push( list[i] );
+ }
+ return new_list;
+}
+
+function find_list(list,f) {
+ for (var i in list) {
+ var t = f( list[i] );
+ if (t) return list[i];
+ }
+ return null;
+}
+
+function map_list(list,f) {
+ var new_list = [];
+ for (var i in list) {
+ new_list.push( f( list[i] ) );
+ }
+ return new_list;
+}
+
+function map_object_to_list(obj,f) {
+ var new_list = [];
+ for (var i in obj) {
+ new_list.push( f( obj, i ) );
+ }
+ return new_list;
+}
+
+function convert_object_list_to_hash(list) {
+ var my_hash = new Object();
+ if (list) {
+ for (var i = 0; i < list.length; i++) {
+ my_hash[ list[i].id() ] = list[i];
+ }
+ }
+ return my_hash;
+}
+
+function find_id_object_in_list(list,id) {
+ //dump('find_id_object_in_list(' + js2JSON(list).substr(0,20) + '... ,' + id + ')\n');
+ if (list) {
+ for (var i = 0; i < list.length; i++ ) {
+ try {
+ if ( list[i].id() == id ) {
+ return list[i];
+ }
+ } catch(E) {
+ dump('find_id_object_in_list error, i = ' + i + ' typeof(list[i]) = ' + typeof(list[i]) + ' list[i] = ' + js2JSON(list[i]) + ' : ' + js2JSON(E) + '\n');
+ }
+ }
+ }
+ //dump('not found\n');
+ return null;
+}
+
+function find_attr_object_in_list(list,attr,value) {
+ if (list) {
+ for (var i = 0; i < list.length; i++ ) {
+ dump('find_attr_object_in_list: i = ' + i + ' id = ' + list[i].id() + '\n');
+ try {
+ var command = 'list[' + i + '].'+attr+'() == ' + value;
+ if ( eval(command) ) {
+ return list[i];
+ }
+ } catch(E) {
+ dump('find_attr_object_in_list error, i = ' + i + ' typeof(list[i]) = ' + typeof(list[i]) + ' list[i] = ' + js2JSON(list[i]) + ' : list = ' + js2JSON(list) + ' : ' + js2JSON(E) + '\n');
+ }
+ }
+ }
+ return null;
+}
+
+function find_ou_by_shortname(tree,sn) {
+ var ou = new aou();
+ if (tree.shortname()==sn) {
+ return tree;
+ }
+ for (var i in tree.children()) {
+ var child = tree.children()[i];
+ ou = find_ou_by_shortname( child, sn );
+ if (ou) { return ou; }
+ }
+ return null;
+}
+
+function populate_listbox_with_local_stat_cats_myself(local_stat_cats,local_cat_entries,listbox,libs,app,method,editable) {
+ dump('populate_local_stat_cats: pertinent libs = ' + js2JSON(libs) + '\n');
+
+ local_stat_cats = user_request(
+ app,
+ method,
+ [ mw.G.auth_ses[0], libs ]
+ )[0];
+ //dump('local_stat_cats = ' + pretty_print( js2JSON( local_stat_cats ) ) + '\n');
+
+ var list = listbox;
+ if (typeof list != 'object') list = document.getElementById(list);
+
+ for (var i in local_stat_cats) {
+
+ var stat_cat = local_stat_cats[i];
+
+ var listitem = document.createElement('listitem');
+ list.appendChild(listitem);
+ listitem.setAttribute('allowevents','true');
+ dump('listitem = ' + listitem + '\n');
+
+ var label = document.createElement('listcell');
+ listitem.appendChild(label);
+ label.setAttribute('label',stat_cat.name() );
+ dump('\tlistcell = ' + label + '\n');
+
+ var menucell = document.createElement('listcell');
+ listitem.appendChild(menucell);
+ dump('\tlistcell = ' + menucell + '\n');
+
+ var menulist = document.createElement('menulist');
+ menucell.appendChild(menulist);
+ if (editable) { menulist.setAttribute('editable','true'); }
+ menulist.setAttribute('id','menulist_stat_cat_'+stat_cat.id());
+ dump('\tmenulist = ' + menulist + '\n');
+
+ var menupopup = document.createElement('menupopup');
+ menulist.appendChild(menupopup);
+ menupopup.setAttribute('stat_cat',stat_cat.id());
+ menupopup.setAttribute('oncommand','apply_attribute(event);');
+ dump('\t\tmenupopup = ' + menupopup + '\n');
+
+ for (var j in stat_cat.entries() ) {
+
+ var stat_entry = stat_cat.entries()[j];
+ local_stat_cat_entries[stat_entry.id()] = stat_entry;
+
+ var menuitem = document.createElement('menuitem');
+ menupopup.appendChild(menuitem);
+ menuitem.setAttribute('label',stat_entry.value());
+ if (editable) {
+ menuitem.setAttribute('value',stat_entry.value());
+ } else {
+ menuitem.setAttribute('value',stat_entry.id());
+ }
+ menuitem.setAttribute('stat_cat',stat_cat.id());
+ menuitem.setAttribute('id','menuitem_stat_cat_entry_' + stat_entry.id());
+ dump('\t\t\tmenuitem = ' + menuitem + '\n');
+
+ }
+
+ }
+
+ //dump('local_stat_cat_entries = ' + pretty_print( js2JSON( local_stat_cat_entries ) ) + '\n');
+
+}
+
+function populate_rows_with_local_stat_cats(local_stat_cats,local_stat_cat_entries,rows,editable) {
+ //dump('populate_local_stat_cats: pertinent libs = ' + js2JSON(libs) + '\n');
+
+ /*local_stat_cats = user_request(
+ app,
+ method,
+ [ mw.G.auth_ses[0], libs ]
+ )[0];*/
+ //dump('local_stat_cats = ' + pretty_print( js2JSON( local_stat_cats ) ) + '\n');
+
+ if (typeof rows != 'object') rows = document.getElementById(rows);
+
+ for (var i in local_stat_cats) {
+
+ var stat_cat = local_stat_cats[i];
+
+ var row = document.createElement('row');
+ rows.appendChild(row);
+
+ var label = document.createElement('label');
+ label.setAttribute('value',stat_cat.name());
+ row.appendChild(label);
+
+ var menulist = document.createElement('menulist');
+ row.appendChild(menulist);
+ if (editable) { menulist.setAttribute('editable','true'); }
+ menulist.setAttribute('id','menulist_stat_cat_'+stat_cat.id());
+ menulist.setAttribute('stat_cat_id',stat_cat.id());
+ dump('\tmenulist = ' + menulist + '\n');
+
+ var menupopup = document.createElement('menupopup');
+ menulist.appendChild(menupopup);
+ menupopup.setAttribute('stat_cat',stat_cat.id());
+ menupopup.setAttribute('command','cmd_apply');
+ dump('\t\tmenupopup = ' + menupopup + '\n');
+
+ for (var j in stat_cat.entries() ) {
+
+ var stat_entry = stat_cat.entries()[j];
+ local_stat_cat_entries[stat_entry.id()] = stat_entry;
+
+ var menuitem = document.createElement('menuitem');
+ menupopup.appendChild(menuitem);
+ menuitem.setAttribute('label',stat_entry.value());
+ if (editable) {
+ menuitem.setAttribute('value',stat_entry.value());
+ } else {
+ menuitem.setAttribute('value',stat_entry.id());
+ }
+ menuitem.setAttribute('stat_cat',stat_cat.id());
+ menuitem.setAttribute('id','menuitem_stat_cat_entry_' + stat_entry.id());
+ dump('\t\t\tmenuitem = ' + menuitem + '\n');
+
+ }
+
+ }
+
+ //dump('local_stat_cat_entries = ' + pretty_print( js2JSON( local_stat_cat_entries ) ) + '\n');
+
+}
+
+function populate_copy_status_list(menulist,menupopup,defaultccs) {
+ dump('populate_copy_status_list\n');
+ var popup = document.getElementById(menupopup);
+
+ if (popup) {
+ empty_widget(popup);
+ for (var i in mw.G.ccs_list) {
+ var menuitem = document.createElement('menuitem');
+ menuitem.setAttribute('label', mw.G.ccs_list[i].name());
+ menuitem.setAttribute('value', mw.G.ccs_list[i].id());
+ menuitem.setAttribute('id', 'ccsitem' + mw.G.ccs_list[i].id());
+ //dump('pop_ccs_list: i = ' + i + ' ccs = ' + mw.G.ccs_list[i] + ' = ' + js2JSON(mw.G.ccs_list[i]) + '\n');
+ popup.appendChild(menuitem);
+ }
+ var list = document.getElementById(menulist);
+ if (list && defaultccs) {
+ if (typeof defaultccs == 'object') {
+ defaultccs = defaultccs.id();
+ }
+ var menuitem_id = 'ccsitem' + defaultccs;
+ var menuitem = document.getElementById(
+ menuitem_id
+ );
+ var menulist_e = document.getElementById(menulist);
+ if (menulist_e && menuitem) {
+ dump('Setting default ccs\n');
+ menulist_e.selectedItem = menuitem;
+ } else {
+ dump('Not Setting default ccs\n');
+ }
+ }
+ } else {
+ dump('populate_copy_status_list: Could not find menupopup: ' + menupopup + '\n');
+ throw('populate_copy_status_list: Could not find menupopup: ' + menupopup + '\n');
+ }
+
+}
+
+function populate_copy_location_list(menulist,menupopup,defaultacpl) {
+ dump('populate_copy_location_list\n');
+ var popup = document.getElementById(menupopup);
+
+ if (popup) {
+ empty_widget(popup);
+ for (var i in mw.G.acpl_my_orgs) {
+ var menuitem = document.createElement('menuitem');
+ menuitem.setAttribute('label', mw.G.acpl_my_orgs[i].name());
+ menuitem.setAttribute('value', mw.G.acpl_my_orgs[i].id());
+ menuitem.setAttribute('id', 'acplitem' + mw.G.acpl_my_orgs[i].id());
+ //dump('populate_copy_location_list: i = ' + i + ' acpl_my_orgs = ' + mw.G.acpl_my_orgs[i] + ' = ' + js2JSON(mw.G.acpl_my_orgs[i]) + '\n');
+ popup.appendChild(menuitem);
+ }
+ var list = document.getElementById(menulist);
+ if (list && defaultacpl) {
+ if (typeof defaultacpl == 'object') {
+ defaultacpl = defaultacpl.id();
+ }
+ var menuitem_id = 'acplitem' + defaultacpl;
+ var menuitem = document.getElementById(
+ menuitem_id
+ );
+ var menulist_e = document.getElementById(menulist);
+ if (menulist_e && menuitem) { menulist_e.selectedItem = menuitem; }
+ }
+ } else {
+ dump('populate_copy_location_list: Could not find menupopup: ' + menupopup + '\n');
+ throw('populate_copy_location_list: Could not find menupopup: ' + menupopup + '\n');
+ }
+
+}
+
+function populate_lib_list(menulist,menupopup,defaultlib,id_flag) {
+ dump('populate_lib_list\n');
+ var default_menuitem;
+ if (typeof defaultlib == 'object') {
+ defaultlib = defaultlib.id();
+ }
+ var popup = menupopup;
+ if (typeof(popup)!='object') { popup = document.getElementById(menupopup); }
+ if (popup) {
+ //dump('found popup\n');
+ empty_widget(popup);
+ var padding_flag = false;
+ for (var ou in mw.G.my_orgs) {
+ //dump('\tlooping on my_orgs: ' + js2JSON(mw.G.my_orgs[ou]) + '\n');
+ //dump('\tlooping on my_orgs: ou = ' + ou + '\n');
+ var menuitem = document.createElement('menuitem');
+ popup.appendChild(menuitem);
+ //dump('\t\tmenuitem = ' + menuitem + '\n');
+ var padding = '';
+ //var depth = find_id_object_in_list( mw.G.aout_list, mw.G.my_orgs[ou].ou_type() ).depth();
+ var depth = mw.G.aout_hash[ mw.G.my_orgs[ou].ou_type() ].depth();
+ if (depth == '0') { padding_flag = true; }
+ if (padding_flag) {
+ for (var i = 0; i < depth; i++) {
+ padding = padding + ' ';
+ }
+ }
+ menuitem.setAttribute('label', padding + mw.G.my_orgs[ou].name() );
+ menuitem.setAttribute('value', mw.G.my_orgs[ou].id() );
+ if (id_flag) menuitem.setAttribute('id', 'libitem' + mw.G.my_orgs[ou].id() );
+ //dump('\tname = ' + mw.G.my_orgs[ou].name() + ' id = ' + mw.G.my_orgs[ou].id() + '\n');
+ if (defaultlib == mw.G.my_orgs[ou].id()) {
+ default_menuitem = menuitem;
+ dump('Setting defaultlib = ' + defaultlib + '\n');
+ }
+ }
+ var list = menulist;
+ if (typeof(list)!='object') { list = document.getElementById(menulist); }
+ if (list && defaultlib && default_menuitem) {
+ //dump('default_menuitem = ' + default_menuitem + '\n');
+ if (list) { list.selectedItem = default_menuitem; }
+ }
+ } else {
+ dump('populate_lib_list: Could not find ' + menupopup + '\n');
+ throw('populate_lib_list: Could not find ' + menupopup + '\n');
+ }
+}
+
+function populate_lib_list_with_branch(menulist,menupopup,defaultlib,branch,id_flag) {
+ dump('populate_lib_list_with_branch\n');
+ var default_menuitem;
+ if (typeof defaultlib == 'object') {
+ defaultlib = defaultlib.id();
+ }
+ var popup = menupopup;
+ if (typeof(popup)!='object') popup = document.getElementById(menupopup);
+ if (popup) {
+ empty_widget(popup);
+ var padding_flag = true;
+ var flat_branch = flatten_ou_branch( branch );
+ //dump('\n\nflat_branch = ' + js2JSON(flat_branch) + '\n');
+ for (var i in flat_branch) {
+ //dump('i = ' + js2JSON(i) + ' flat_branch[i] = ' + js2JSON(flat_branch[i]) + '\n');
+ var menuitem = document.createElement('menuitem');
+ var padding = '';
+ //if (flat_branch[i].ou_type().depth() == '0') { padding_flag = true; }
+ var depth = mw.G.aout_hash[ flat_branch[i].ou_type() ].depth();
+ if (padding_flag) {
+ for (var j = 0; j < depth; j++) {
+ padding = padding + ' ';
+ }
+ }
+ menuitem.setAttribute('label', padding + flat_branch[i].name() );
+ menuitem.setAttribute('value', flat_branch[i].id() );
+ if (id_flag) menuitem.setAttribute('id', 'libitem' + flat_branch[i].id() );
+ if (defaultlib == flat_branch[i].id()) {
+ default_menuitem = menuitem;
+ dump('i = ' + i + ' Setting defaultlib = ' + defaultlib + ' menuitem = ' + default_menuitem + ' value = ' + default_menuitem.getAttribute('value') + '\n');
+ }
+ popup.appendChild(menuitem);
+ }
+ var list = menulist;
+ if (typeof(list)!='object') { list = document.getElementById(menulist); }
+ if (list && defaultlib && default_menuitem) {
+ //dump('default_menuitem = ' + default_menuitem + ' value = ' + default_menuitem.getAttribute('value') + '\n');
+ if (list) { list.selectedItem = default_menuitem; }
+ }
+ } else {
+ dump('populate_lib_list_with_branch: Could not find ' + menupopup + '\n');
+ throw('populate_lib_list_with_branch: Could not find ' + menupopup + '\n');
+ }
+ dump('\tleaving populate_lib_list_with_branch\n');
+}
+
+function populate_user_profile(menulist,menupopup,defaultap) {
+ dump('Entering populate_user_profile\n');
+ var popup = document.getElementById(menupopup);
+ if (popup) {
+ empty_widget(popup);
+ for (var i in mw.G.ap_list) {
+ var menuitem = document.createElement('menuitem');
+ menuitem.setAttribute('label', mw.G.ap_list[i].name());
+ menuitem.setAttribute('value', mw.G.ap_list[i].id());
+ menuitem.setAttribute('id', 'apitem' + mw.G.ap_list[i].id());
+ //dump('pop_ap_list: i = ' + i + ' ap = ' + mw.G.ap_list[i] + ' = ' + js2JSON(mw.G.ap_list[i]) + '\n');
+ popup.appendChild(menuitem);
+ }
+ var list = document.getElementById(menulist);
+ if (list && defaultap) {
+ if (typeof defaultap == 'object') {
+ defaultap = defaultap.id();
+ }
+ var menuitem_id = 'apitem' + defaultap;
+ var menuitem = document.getElementById(
+ menuitem_id
+ );
+ var menulist_e = document.getElementById(menulist);
+ if (menulist_e) { menulist_e.selectedItem = menuitem; }
+ }
+ } else {
+ dump('populate_user_profile: Could not find menupopup: ' + menupopup + '\n');
+ throw('populate_user_profile: Could not find menupopup: ' + menupopup + '\n');
+ }
+}
+
+function populate_ident_types(menulist,menupopup,repeatid,defaultcit) {
+ dump('Entering populate_ident_types\n');
+ var popup = document.getElementById(menupopup);
+ if (popup) {
+ empty_widget(popup);
+ for (var i in mw.G.cit_list) {
+ var menuitem = document.createElement('menuitem');
+ menuitem.setAttribute('label', mw.G.cit_list[i].name());
+ menuitem.setAttribute('value', mw.G.cit_list[i].id());
+ menuitem.setAttribute('id', 'cit' + repeatid + 'item' + mw.G.cit_list[i].id());
+ //dump('pop_cit_list: i = ' + i + ' cit = ' + mw.G.cit_list[i] + ' = ' + js2JSON(mw.G.cit_list[i]) + '\n');
+ popup.appendChild(menuitem);
+ }
+ if (list && defaultcit) {
+ if (typeof defaultcit == 'object') {
+ defaultcit = defaultcit.id();
+ }
+ var menuitem_id = 'cit' + repeatid + 'item' + defaultcit;
+ var menuitem = document.getElementById(
+ menuitem_id
+ );
+ var menulist_e = document.getElementById(menulist);
+ if (menulist_e) { menulist_e.selectedItem = menuitem; }
+ }
+ } else {
+ dump('populate_ident_types: Could not find menupopup: ' + menupopup + '\n');
+ throw('populate_ident_types: Could not find menupopup: ' + menupopup + '\n');
+ }
+}
+
+
+
+function populate_name_prefix(menulist,menupopup,defaultvalue) {
+ var popup = document.getElementById(menupopup);
+ if (popup) {
+ empty_widget(popup);
+ var prefix_list = [
+ 'Mr','Mrs','Ms','Miss', 'Dr',
+ '',
+ 'Advisor',
+ 'Airman',
+ 'Admiral',
+ 'Agent',
+ 'Ambassador',
+ 'Baron',
+ 'Baroness',
+ 'Bishop',
+ 'Brother',
+ 'Cadet',
+ 'Captain',
+ 'Cardinal',
+ 'Chairperson',
+ 'Chancellor',
+ 'Chief',
+ 'Colonel',
+ 'Commander',
+ 'Commodore',
+ 'Congressman',
+ 'Congresswoman',
+ 'Constable',
+ 'Consul',
+ 'Corporal',
+ 'Councilperson',
+ 'Counselor',
+ 'Dean',
+ 'Duchess',
+ 'Duke',
+ 'Elder',
+ 'Ensign',
+ 'Father',
+ 'General',
+ 'Governor',
+ 'Judge',
+ 'Justice',
+ 'King',
+ 'Lady',
+ 'Lieutenant',
+ 'Lord',
+ 'Major',
+ 'Marshal',
+ 'Mayor',
+ 'Midshipman',
+ 'Minister',
+ 'Monsignor',
+ 'Officer',
+ 'Pastor',
+ 'Petty Officer',
+ 'Pope',
+ 'Prince',
+ 'Princess',
+ 'President',
+ 'Private',
+ 'Prof',
+ 'Queen',
+ 'Rabbi',
+ 'Representative',
+ 'Reverend',
+ 'Seaman',
+ 'Secretary',
+ 'Senator',
+ 'Sergeant',
+ 'Sheriff',
+ 'Sir',
+ 'Sister',
+ 'Speaker',
+ 'Specialist',
+ 'Treasurer',
+ 'Vice President',
+ 'Warrant Officer'
+ ];
+ for (var i in prefix_list) {
+ var menuitem = document.createElement('menuitem');
+ menuitem.setAttribute('label', prefix_list[i]);
+ menuitem.setAttribute('value', prefix_list[i]);
+ popup.appendChild(menuitem);
+ }
+ var list = document.getElementById(menulist);
+ if (list) {
+ if (defaultvalue) {
+ list.value = defaultvalue;
+ }
+ } else {
+ dump('populate_name_prefix: Could not find menulist: ' + menulist + '\n');
+ throw('populate_name_prefix: Could not find menulist: ' + menulist + '\n');
+ }
+ } else {
+ dump('populate_name_prefix: Could not find menupopup: ' + menupopup + '\n');
+ throw('populate_name_prefix: Could not find menupopup: ' + menupopup + '\n');
+ }
+
+}
+
+function populate_name_suffix(menulist,menupopup,defaultvalue) {
+ var popup = document.getElementById(menupopup);
+ if (popup) {
+ empty_widget(popup);
+ var suffix_list = [
+ 'Jr','Sr','II','III',
+ '',
+ 'AA',
+ 'AS',
+ 'AAS',
+ 'BA',
+ 'BS',
+ 'CFPIM',
+ 'CPA',
+ 'CPIM',
+ 'CPM',
+ 'CXE',
+ 'DC',
+ 'DDS',
+ 'DO',
+ 'DPM',
+ 'DVM',
+ 'Esq',
+ 'FACAAI',
+ 'FACP',
+ 'FACS',
+ 'FACEP',
+ 'FCP',
+ 'FICS',
+ 'GYN',
+ 'JD',
+ 'LPN',
+ 'MA',
+ 'MCSE',
+ 'MD',
+ 'MS',
+ 'NMD',
+ 'OB',
+ 'PhD',
+ 'RN'
+ ];
+ for (var i in suffix_list) {
+ var menuitem = document.createElement('menuitem');
+ menuitem.setAttribute('label', suffix_list[i]);
+ menuitem.setAttribute('value', suffix_list[i]);
+ popup.appendChild(menuitem);
+ }
+ var list = document.getElementById(menulist);
+ if (list) {
+ if (defaultvalue) {
+ list.value = defaultvalue;
+ }
+ } else {
+ dump('populate_name_suffix: Could not find ' + menulist + '\n');
+ throw('populate_name_suffix: Could not find ' + menulist + '\n');
+ }
+ } else {
+ dump('populate_name_suffix: Could not find ' + menupopup + '\n');
+ throw('populate_name_suffix: Could not find ' + menupopup + '\n');
+ }
+
+}
+
--- /dev/null
+dump('Loading win.js\n');
+
+function s_alert(s) {
+ // alert() replacement, intended to stop barcode scanners from "scanning through" the dialog
+
+ // get a reference to the prompt service component.
+ var promptService = Components.classes["@mozilla.org/embedcomp/prompt-service;1"]
+ .getService(Components.interfaces.nsIPromptService);
+
+ // set the buttons that will appear on the dialog. It should be
+ // a set of constants multiplied by button position constants. In this case,
+ // three buttons appear, Save, Cancel and a custom button.
+ //var flags=promptService.BUTTON_TITLE_OK * promptService.BUTTON_POS_0 +
+ // promptService.BUTTON_TITLE_CANCEL * promptService.BUTTON_POS_1 +
+ // promptService.BUTTON_TITLE_IS_STRING * promptService.BUTTON_POS_2;
+ var flags = promptService.BUTTON_TITLE_IS_STRING * promptService.BUTTON_POS_0;
+
+ // display the dialog box. The flags set above are passed
+ // as the fourth argument. The next three arguments are custom labels used for
+ // the buttons, which are used if BUTTON_TITLE_IS_STRING is assigned to a
+ // particular button. The last two arguments are for an optional check box.
+ var check = {};
+ dump('s_alert: ' + s);
+ promptService.confirmEx(window,"ALERT",
+ s,
+ flags,
+ "Enter", null, null,
+ "Check this box to confirm this message",
+ check
+ );
+ if (!check.value) {
+ snd_bad();
+ s_alert(s);
+ }
+}
+
+function new_window(chrome,params) {
+ var name = self.name + '_' + ++mw.G['window_name_increment'];
+ var options = 'chrome,resizable=yes,scrollbars=yes,width=800,height=600,fullscreen=yes';
+ try {
+ if (params) {
+ if (params['window_name']) { name = params.window_name; }
+ if (params['window_options']) { options = params.window_options; }
+ }
+ } catch(E) {
+ }
+ //var w = window.open(
+ var w = SafeWindowOpen(
+ chrome,
+ name,
+ options
+ );
+ if (w) {
+ if (w != self) {
+ w.parentWindow = self;
+ w.mw = mw;
+ register_window(w);
+ }
+ w.am_i_a_top_level_tab = false;
+ if (params) {
+ w.params = params;
+ }
+ }
+ return w;
+}
+
+
+// From: Bryan White on netscape.public.mozilla.xpfe, Oct 13, 2004
+// Message-ID: <ckjh7a$18q1@ripley.netscape.com>
+// Modified to return window handler, and do errors differently
+function SafeWindowOpen(url,title,features)
+{
+ var w;
+
+ netscape.security.PrivilegeManager
+ .enablePrivilege("UniversalXPConnect");
+ const CI = Components.interfaces;
+ const PB =
+ Components.classes["@mozilla.org/preferences-service;1"]
+ .getService(CI.nsIPrefBranch);
+
+ var blocked = false;
+ try
+ {
+ // pref 'dom.disable_open_during_load' is the main popup
+ // blocker preference
+ blocked = PB.getBoolPref("dom.disable_open_during_load");
+ if(blocked)
+ PB.setBoolPref("dom.disable_open_during_load",false);
+ w = window.open(url,title,features);
+ }
+ catch(e)
+ {
+ //alert("SafeWindowOpen error:\n\n" + e);
+ handle_error(e);
+ }
+ if(blocked)
+ PB.setBoolPref("dom.disable_open_during_load",true);
+
+ return w;
+}
+
+function register_window(w) {
+ mw.G['win_list'].push(w);
+}
+
+function register_patron_window(w) { }
+function unregister_patron_window(w) { }
+
+function close_all_windows() {
+ var w;
+ while (w = mw.G['win_list'].pop()) {
+ w.close();
+ }
+}
+
+function spawn_copy_browser(tab,params) {
+ dump('trying to spawn_copy_browser('+js2JSON(params)+')\n');
+ var w;
+ var chrome = 'chrome://evergreen/content/cat/browse_list.xul';
+ if (tab) {
+ if (tab != 'replace') { tabWindow.new_tab('main_tabbox'); }
+ w = tabWindow.replace_tab('main_tabbox','COPIES',chrome);
+ } else {
+ w = mw.new_window( chrome );
+ }
+ w.find_this_id = params[0];
+ w.record_columns = params;
+}
+
+function spawn_batch_copy_editor(tab,params) {
+ dump('trying to spawn_copy_editor(' + params + ')');
+ var w;
+ var chrome = 'chrome://evergreen/content/cat/copy_edit.xul';
+ if (tab) {
+ if (tab != 'replace') { tabWindow.new_tab('main_tabbox'); }
+ w = tabWindow.replace_tab('main_tabbox','COPIES EDITOR',chrome);
+ } else {
+ w = mw.new_window( chrome );
+ }
+ w.params = params;
+}
+
+function spawn_marc_editor(tab,params) {
+ dump('trying to spawn_marc_editor('+js2JSON(params)+')\n');
+ var w;
+ var chrome = 'chrome://evergreen/content/cat/marc.xul';
+ if (tab) {
+ if (tab != 'replace') { tabWindow.new_tab('main_tabbox'); }
+ w = tabWindow.replace_tab('main_tabbox','MARC',chrome);
+ } else {
+ w = mw.new_window( chrome );
+ }
+ w.find_this_id = params[0];
+ w.record_columns = params;
+ w.params = params;
+}
+
+function spawn_oclc_import(tab,params) {
+ dump('trying to spawn_marc_editor('+js2JSON(params)+')\n');
+ // sample TCN: 03715963
+ try {
+ if (params.tcn.length < 6) {
+ throw("Too short. At the moment, we're really doing a search rather than a retrieve, and it's a substring search at that. We grab the result that matches exactly. But sending a short query would just be mean. :)");
+ }
+ var result = user_request(
+ 'open-ils.search',
+ 'open-ils.search.z3950.import',
+ [ mw.G.auth_ses[0], params.tcn ]
+ )[0];
+ if (typeof result == 'object') {
+ if (result.records.length > 0) {
+ params['import_tree'] = result.records[0];
+ } else {
+ throw('no records. result = ' + js2JSON(result) + '\n');
+ }
+ } else {
+ throw('result: ' + js2JSON(result) + '\n');
+ }
+ var w;
+ var chrome = 'chrome://evergreen/content/cat/marc.xul';
+ if (tab) {
+ if (tab != 'replace') { tabWindow.new_tab('main_tabbox'); }
+ w = tabWindow.replace_tab('main_tabbox','MARC',chrome);
+ } else {
+ w = mw.new_window( chrome );
+ }
+ w.params = params;
+ w.find_this_id = -1;
+ //w.record_columns = params;
+
+ } catch(E) {
+ handle_error(E);
+ }
+
+}
+
+function spawn_bill_pay(tab,patron,params) {
+ dump('trying to spawn_bill_pay('+js2JSON(patron)+')\n');
+ dump('barcode: ' + patron.barcode() + '\n');
+ var w;
+ var chrome = 'chrome://evergreen/content/bill/bill.xul';
+ var params = { 'barcode' : patron.barcode() };
+ if (tab) {
+ if (tab != 'replace') { tabWindow.new_tab('main_tabbox'); }
+ w = tabWindow.replace_tab('main_tabbox','BILLS',chrome,params);
+ } else {
+ w = mw.new_window( chrome,params );
+ }
+}
+
+function spawn_check_out(tab,patron,params) {
+ dump('trying to spawn_check_out('+js2JSON(patron)+')\n');
+ dump('barcode: ' + patron.barcode() + '\n');
+ var w;
+ var chrome = 'chrome://evergreen/content/circ/checkout.xul';
+ var params = { 'barcode' : patron.barcode() };
+ if (tab) {
+ if (tab != 'replace') { tabWindow.new_tab('main_tabbox'); }
+ w = tabWindow.replace_tab('main_tabbox','CHECK OUT',chrome,params);
+ } else {
+ w = mw.new_window( chrome,params );
+ }
+}
+
+function spawn_circ_list(tab,patron,params) {
+ dump('trying to spawn_circ_list('+js2JSON(patron)+')\n');
+ dump('barcode: ' + patron.barcode() + '\n');
+ var w;
+ var chrome = 'chrome://evergreen/content/circ/circ_list.xul';
+ var params = { 'barcode' : patron.barcode() };
+ if (tab) {
+ if (tab != 'replace') { tabWindow.new_tab('main_tabbox'); }
+ w = tabWindow.replace_tab('main_tabbox','ITEMS OUT',chrome,params);
+ } else {
+ w = mw.new_window( chrome,params );
+ }
+}
+
+function spawn_patron_edit(tab,patron,params) {
+ dump('trying to spawn_patron_edit('+js2JSON(patron)+')\n');
+ dump('barcode: ' + patron.barcode() + '\n');
+ var w;
+ var chrome = 'chrome://evergreen/content/patron/patron_edit.xul';
+ var params = { 'barcode' : patron.barcode() };
+ if (tab) {
+ if (tab != 'replace') { tabWindow.new_tab('main_tabbox'); }
+ w = tabWindow.replace_tab('main_tabbox','PATRON EDIT',chrome,params);
+ } else {
+ w = mw.new_window( chrome, params );
+ }
+}
+
+function spawn_test() {
+ var chrome = 'chrome://evergreen/content/patron/patron_edit.xul';
+ var params = { 'barcode':'101010101010101' };
+ var w = tabWindow.replace_tab('main_tabbox','TEST',chrome,params);
+}
+
+
projects / Evergreen.git / commitdiff